Application
DEAE-Cellulose is used in ion exchange chromatography, protein chromatography and anion exchange media. DEAE cellulose has been used to study acute myocardial infarction
Phsical form | Functional group | Normal pH range | Small ion capacity (meq/dg*) | Protein Capacity‡ | Packing density (g†/ml) |
(mg/dg*) | (mg/ml) |
Dry Fibrous | | | | | | |
DE23 | Diethylaminoethyl | 2 to 9.5 | 0.88 to 1.08 | 425 | 60 | 0.15 |
Dry Microgranular | | | | | |
DE32 | Diethylaminoethyl | 2 to 9.5 | 0.88 to 1.08 | 700 | 140 | 0.24 |
Preswollen Microgranular | | | | | |
DE52 | Diethylaminoethyl | 2 to 9.5 | 0.88 to 1.08 | 700 | 130 | 0.9 |
DE53 | Diethylaminoethyl | 2 to 12 | 1.8 to 2.2 | 750 | 150 | 1.1 |
QA52 | Quaternary Ammonium | 2 to 12 | 1.1 | 750 | 150 | 1.2 |
性质
form | preswollen, microgranular |
contains | ~70% moisture content |
capacity | ~0.3 meq/g(as supplied) |
| ~1.0 meq/g(dry) |
SMILES string | OC[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@H](O)[C@@H](O)O[C@H]2CO)[C@@H](O)[C@H](O)[C@H]1OInChI | 1S/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3?,4?,5?,6?,7?,8?,9?,10-,11?,12+/m1/s1InChI key | GUBGYTABKSRVRQ-WFVLMXAXSA-N | | |
安全信息
RIDADR NONH for all modes of transport